C25H25FN6O3 — CID 71747524
N-[(E)-[7-(4-acetylpiperazin-1-yl)-1-cyclopropyl-6-fluoro-4-oxoquinolin-3-yl]methylideneamino]pyridine-4-carboxamide (PubChem CID 71747524) has the molecular formula C25H25FN6O3 and a molecular weight of 476.51 g/mol. Its IUPAC name is N-[(E)-[7-(4-acetylpiperazin-1-yl)-1-cyclopropyl-6-fluoro-4-oxoquinolin-3-yl]methylideneamino]pyridine-4-carboxamide.
| Compound Name | N-[(E)-[7-(4-acetylpiperazin-1-yl)-1-cyclopropyl-6-fluoro-4-oxoquinolin-3-yl]methylideneamino]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 71747524 |
| Molecular Formula | C25H25FN6O3 |
| Molecular Weight | 476.51 g/mol |
| Exact Mass | 476.20 |
| IUPAC Name | N-[(E)-[7-(4-acetylpiperazin-1-yl)-1-cyclopropyl-6-fluoro-4-oxoquinolin-3-yl]methylideneamino]pyridine-4-carboxamide |
| SMILES | CC(=O)N1CCN(c2cc3c(cc2F)c(=O)c(/C=N/NC(=O)c2ccncc2)cn3C2CC2)CC1 |
| InChI | InChI=1S/C25H25FN6O3/c1-16(33)30-8-10-31(11-9-30)23-13-22-20(12-21(23)26)24(34)18(15-32(22)19-2-3-19)14-28-29-25(35)17-4-6-27-7-5-17/h4-7,12-15,19H,2-3,8-11H2,1H3,(H,29,35)/b28-14+ |
| InChIKey | VZNBUOODBQGWNJ-CCVNUDIWSA-N |
| XLogP | 2.30 |
| TPSA | 99.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.51 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|