C18H22FN4O+ — CID 147005607
[1-cyclopropyl-6-fluoro-7-(4-methylpiperazin-1-yl)-4-oxoquinolin-3-yl]methylideneazanium (PubChem CID 147005607) has the molecular formula C18H22FN4O+ and a molecular weight of 329.40 g/mol. Its IUPAC name is [1-cyclopropyl-6-fluoro-7-(4-methylpiperazin-1-yl)-4-oxoquinolin-3-yl]methylideneazanium.
| Compound Name | [1-cyclopropyl-6-fluoro-7-(4-methylpiperazin-1-yl)-4-oxoquinolin-3-yl]methylideneazanium |
|---|---|
| PubChem CID | 147005607 |
| Molecular Formula | C18H22FN4O+ |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.18 |
| IUPAC Name | [1-cyclopropyl-6-fluoro-7-(4-methylpiperazin-1-yl)-4-oxoquinolin-3-yl]methylideneazanium |
| SMILES | CN1CCN(c2cc3c(cc2F)c(=O)c(C=[NH2+])cn3C2CC2)CC1 |
| InChI | InChI=1S/C18H21FN4O/c1-21-4-6-22(7-5-21)17-9-16-14(8-15(17)19)18(24)12(10-20)11-23(16)13-2-3-13/h8-11,13,20H,2-7H2,1H3/p+1 |
| InChIKey | ASWQLDNZRQEMLK-UHFFFAOYSA-O |
| XLogP | 0.41 |
| TPSA | 54.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|