C29H31FN4O3 — CID 142486806
1-cyclopropyl-6-fluoro-4-oxo-7-[4-[(4-pyrrol-1-ylphenyl)methyl]piperazin-1-yl]quinoline-3-carbaldehyde;methanol (PubChem CID 142486806) has the molecular formula C29H31FN4O3 and a molecular weight of 502.59 g/mol. Its IUPAC name is 1-cyclopropyl-6-fluoro-4-oxo-7-[4-[(4-pyrrol-1-ylphenyl)methyl]piperazin-1-yl]quinoline-3-carbaldehyde;methanol.
| Compound Name | 1-cyclopropyl-6-fluoro-4-oxo-7-[4-[(4-pyrrol-1-ylphenyl)methyl]piperazin-1-yl]quinoline-3-carbaldehyde;methanol |
|---|---|
| PubChem CID | 142486806 |
| Molecular Formula | C29H31FN4O3 |
| Molecular Weight | 502.59 g/mol |
| Exact Mass | 502.24 |
| IUPAC Name | 1-cyclopropyl-6-fluoro-4-oxo-7-[4-[(4-pyrrol-1-ylphenyl)methyl]piperazin-1-yl]quinoline-3-carbaldehyde;methanol |
| SMILES | CO.O=Cc1cn(C2CC2)c2cc(N3CCN(Cc4ccc(-n5cccc5)cc4)CC3)c(F)cc2c1=O |
| InChI | InChI=1S/C28H27FN4O2.CH4O/c29-25-15-24-26(33(23-7-8-23)18-21(19-34)28(24)35)16-27(25)32-13-11-30(12-14-32)17-20-3-5-22(6-4-20)31-9-1-2-10-31;1-2/h1-6,9-10,15-16,18-19,23H,7-8,11-14,17H2;2H,1H3 |
| InChIKey | LLYUEFAWGTWPDV-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 70.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.59 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|