C28H29FN4O3 — CID 142486802
1-cyclopropyl-6-fluoro-4-oxo-7-[4-(quinolin-8-ylmethyl)piperazin-1-yl]quinoline-3-carbaldehyde;methanol (PubChem CID 142486802) has the molecular formula C28H29FN4O3 and a molecular weight of 488.56 g/mol. Its IUPAC name is 1-cyclopropyl-6-fluoro-4-oxo-7-[4-(quinolin-8-ylmethyl)piperazin-1-yl]quinoline-3-carbaldehyde;methanol.
| Compound Name | 1-cyclopropyl-6-fluoro-4-oxo-7-[4-(quinolin-8-ylmethyl)piperazin-1-yl]quinoline-3-carbaldehyde;methanol |
|---|---|
| PubChem CID | 142486802 |
| Molecular Formula | C28H29FN4O3 |
| Molecular Weight | 488.56 g/mol |
| Exact Mass | 488.22 |
| IUPAC Name | 1-cyclopropyl-6-fluoro-4-oxo-7-[4-(quinolin-8-ylmethyl)piperazin-1-yl]quinoline-3-carbaldehyde;methanol |
| SMILES | CO.O=Cc1cn(C2CC2)c2cc(N3CCN(Cc4cccc5cccnc45)CC3)c(F)cc2c1=O |
| InChI | InChI=1S/C27H25FN4O2.CH4O/c28-23-13-22-24(32(21-6-7-21)16-20(17-33)27(22)34)14-25(23)31-11-9-30(10-12-31)15-19-4-1-3-18-5-2-8-29-26(18)19;1-2/h1-5,8,13-14,16-17,21H,6-7,9-12,15H2;2H,1H3 |
| InChIKey | WIQRGXXQJDUCHL-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.56 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|