C31H31FN4O2 — CID 123889244
1-cyclopropyl-3-(1,1-diphenylethoxyiminomethyl)-6-fluoro-7-piperazin-1-ylquinolin-4-one (PubChem CID 123889244) has the molecular formula C31H31FN4O2 and a molecular weight of 510.61 g/mol. Its IUPAC name is 1-cyclopropyl-3-(1,1-diphenylethoxyiminomethyl)-6-fluoro-7-piperazin-1-ylquinolin-4-one.
| Compound Name | 1-cyclopropyl-3-(1,1-diphenylethoxyiminomethyl)-6-fluoro-7-piperazin-1-ylquinolin-4-one |
|---|---|
| PubChem CID | 123889244 |
| Molecular Formula | C31H31FN4O2 |
| Molecular Weight | 510.61 g/mol |
| Exact Mass | 510.24 |
| IUPAC Name | 1-cyclopropyl-3-(1,1-diphenylethoxyiminomethyl)-6-fluoro-7-piperazin-1-ylquinolin-4-one |
| SMILES | CC(ON=Cc1cn(C2CC2)c2cc(N3CCNCC3)c(F)cc2c1=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H31FN4O2/c1-31(23-8-4-2-5-9-23,24-10-6-3-7-11-24)38-34-20-22-21-36(25-12-13-25)28-19-29(35-16-14-33-15-17-35)27(32)18-26(28)30(22)37/h2-11,18-21,25,33H,12-17H2,1H3 |
| InChIKey | DSQHQDCWZSPDGU-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 58.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.61 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|