C20H20FN3OS3 — CID 155815965
1-cyclopropyl-6-fluoro-3-(4-methyl-5-sulfanylidenedithiol-3-yl)-7-piperazin-1-ylquinolin-4-one (PubChem CID 155815965) has the molecular formula C20H20FN3OS3 and a molecular weight of 433.60 g/mol. Its IUPAC name is 1-cyclopropyl-6-fluoro-3-(4-methyl-5-sulfanylidenedithiol-3-yl)-7-piperazin-1-ylquinolin-4-one.
| Compound Name | 1-cyclopropyl-6-fluoro-3-(4-methyl-5-sulfanylidenedithiol-3-yl)-7-piperazin-1-ylquinolin-4-one |
|---|---|
| PubChem CID | 155815965 |
| Molecular Formula | C20H20FN3OS3 |
| Molecular Weight | 433.60 g/mol |
| Exact Mass | 433.08 |
| IUPAC Name | 1-cyclopropyl-6-fluoro-3-(4-methyl-5-sulfanylidenedithiol-3-yl)-7-piperazin-1-ylquinolin-4-one |
| SMILES | Cc1c(-c2cn(C3CC3)c3cc(N4CCNCC4)c(F)cc3c2=O)ssc1=S |
| InChI | InChI=1S/C20H20FN3OS3/c1-11-19(27-28-20(11)26)14-10-24(12-2-3-12)16-9-17(23-6-4-22-5-7-23)15(21)8-13(16)18(14)25/h8-10,12,22H,2-7H2,1H3 |
| InChIKey | DTWIWOMAFMVHCW-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.60 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|