C20H24FN3O5 — CID 174787606
1-cyclopropyl-6-fluoro-4-oxo-7-piperazin-1-ylquinoline-3-carboxylic acid;propanoic acid (PubChem CID 174787606) has the molecular formula C20H24FN3O5 and a molecular weight of 405.43 g/mol. Its IUPAC name is 1-cyclopropyl-6-fluoro-4-oxo-7-piperazin-1-ylquinoline-3-carboxylic acid;propanoic acid.
| Compound Name | 1-cyclopropyl-6-fluoro-4-oxo-7-piperazin-1-ylquinoline-3-carboxylic acid;propanoic acid |
|---|---|
| PubChem CID | 174787606 |
| Molecular Formula | C20H24FN3O5 |
| Molecular Weight | 405.43 g/mol |
| Exact Mass | 405.17 |
| IUPAC Name | 1-cyclopropyl-6-fluoro-4-oxo-7-piperazin-1-ylquinoline-3-carboxylic acid;propanoic acid |
| SMILES | CCC(=O)O.O=C(O)c1cn(C2CC2)c2cc(N3CCNCC3)c(F)cc2c1=O |
| InChI | InChI=1S/C17H18FN3O3.C3H6O2/c18-13-7-11-14(8-15(13)20-5-3-19-4-6-20)21(10-1-2-10)9-12(16(11)22)17(23)24;1-2-3(4)5/h7-10,19H,1-6H2,(H,23,24);2H2,1H3,(H,4,5) |
| InChIKey | JCOQKFYIOZKVRB-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 111.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.43 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |