C32H36F2N6O2 — CID 163746100
1-cyclopropyl-3-[(E)-(1-ethyl-6-fluoro-4-oxo-7-piperazin-1-yl-2H-quinolin-3-ylidene)methyl]-6-fluoro-7-piperazin-1-ylquinolin-4-one (PubChem CID 163746100) has the molecular formula C32H36F2N6O2 and a molecular weight of 574.68 g/mol. Its IUPAC name is 1-cyclopropyl-3-[(E)-(1-ethyl-6-fluoro-4-oxo-7-piperazin-1-yl-2H-quinolin-3-ylidene)methyl]-6-fluoro-7-piperazin-1-ylquinolin-4-one.
| Compound Name | 1-cyclopropyl-3-[(E)-(1-ethyl-6-fluoro-4-oxo-7-piperazin-1-yl-2H-quinolin-3-ylidene)methyl]-6-fluoro-7-piperazin-1-ylquinolin-4-one |
|---|---|
| PubChem CID | 163746100 |
| Molecular Formula | C32H36F2N6O2 |
| Molecular Weight | 574.68 g/mol |
| Exact Mass | 574.29 |
| IUPAC Name | 1-cyclopropyl-3-[(E)-(1-ethyl-6-fluoro-4-oxo-7-piperazin-1-yl-2H-quinolin-3-ylidene)methyl]-6-fluoro-7-piperazin-1-ylquinolin-4-one |
| SMILES | CCN1C/C(=C\c2cn(C3CC3)c3cc(N4CCNCC4)c(F)cc3c2=O)C(=O)c2cc(F)c(N3CCNCC3)cc21 |
| InChI | InChI=1S/C32H36F2N6O2/c1-2-37-18-20(31(41)23-14-25(33)29(16-27(23)37)38-9-5-35-6-10-38)13-21-19-40(22-3-4-22)28-17-30(39-11-7-36-8-12-39)26(34)15-24(28)32(21)42/h13-17,19,22,35-36H,2-12,18H2,1H3/b20-13+ |
| InChIKey | LLZXXYIOLDXASU-DEDYPNTBSA-N |
| XLogP | 3.54 |
| TPSA | 72.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.68 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|