C24H24FN5O3 — CID 175119351
7-(4-acetylpiperazin-1-yl)-1-ethyl-6-fluoro-3-(3-pyridin-3-ylprop-2-enoyl)-1,8-naphthyridin-4-one (PubChem CID 175119351) has the molecular formula C24H24FN5O3 and a molecular weight of 449.49 g/mol. Its IUPAC name is 7-(4-acetylpiperazin-1-yl)-1-ethyl-6-fluoro-3-(3-pyridin-3-ylprop-2-enoyl)-1,8-naphthyridin-4-one.
| Compound Name | 7-(4-acetylpiperazin-1-yl)-1-ethyl-6-fluoro-3-(3-pyridin-3-ylprop-2-enoyl)-1,8-naphthyridin-4-one |
|---|---|
| PubChem CID | 175119351 |
| Molecular Formula | C24H24FN5O3 |
| Molecular Weight | 449.49 g/mol |
| Exact Mass | 449.19 |
| IUPAC Name | 7-(4-acetylpiperazin-1-yl)-1-ethyl-6-fluoro-3-(3-pyridin-3-ylprop-2-enoyl)-1,8-naphthyridin-4-one |
| SMILES | CCn1cc(C(=O)C=Cc2cccnc2)c(=O)c2cc(F)c(N3CCN(C(C)=O)CC3)nc21 |
| InChI | InChI=1S/C24H24FN5O3/c1-3-28-15-19(21(32)7-6-17-5-4-8-26-14-17)22(33)18-13-20(25)24(27-23(18)28)30-11-9-29(10-12-30)16(2)31/h4-8,13-15H,3,9-12H2,1-2H3 |
| InChIKey | AVMPQDJPVWGISE-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 88.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.49 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|