C28H29F2N3O4 — CID 175132181
7-(4-acetyl-3-methylpiperazin-1-yl)-1-ethyl-6,8-difluoro-3-[(E)-3-(4-methoxyphenyl)prop-2-enoyl]quinolin-4-one (PubChem CID 175132181) has the molecular formula C28H29F2N3O4 and a molecular weight of 509.55 g/mol. Its IUPAC name is 7-(4-acetyl-3-methylpiperazin-1-yl)-1-ethyl-6,8-difluoro-3-[(E)-3-(4-methoxyphenyl)prop-2-enoyl]quinolin-4-one.
| Compound Name | 7-(4-acetyl-3-methylpiperazin-1-yl)-1-ethyl-6,8-difluoro-3-[(E)-3-(4-methoxyphenyl)prop-2-enoyl]quinolin-4-one |
|---|---|
| PubChem CID | 175132181 |
| Molecular Formula | C28H29F2N3O4 |
| Molecular Weight | 509.55 g/mol |
| Exact Mass | 509.21 |
| IUPAC Name | 7-(4-acetyl-3-methylpiperazin-1-yl)-1-ethyl-6,8-difluoro-3-[(E)-3-(4-methoxyphenyl)prop-2-enoyl]quinolin-4-one |
| SMILES | CCn1cc(C(=O)/C=C/c2ccc(OC)cc2)c(=O)c2cc(F)c(N3CCN(C(C)=O)C(C)C3)c(F)c21 |
| InChI | InChI=1S/C28H29F2N3O4/c1-5-31-16-22(24(35)11-8-19-6-9-20(37-4)10-7-19)28(36)21-14-23(29)27(25(30)26(21)31)32-12-13-33(18(3)34)17(2)15-32/h6-11,14,16-17H,5,12-13,15H2,1-4H3/b11-8+ |
| InChIKey | NWYGWDKMUYUJDV-DHZHZOJOSA-N |
| XLogP | 4.26 |
| TPSA | 71.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.55 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|