C26H26F3N3O3 — CID 175029806
6,8-difluoro-1-(2-fluoroethyl)-3-[3-(4-methoxyphenyl)prop-2-enoyl]-7-(4-methylpiperazin-1-yl)quinolin-4-one (PubChem CID 175029806) has the molecular formula C26H26F3N3O3 and a molecular weight of 485.51 g/mol. Its IUPAC name is 6,8-difluoro-1-(2-fluoroethyl)-3-[3-(4-methoxyphenyl)prop-2-enoyl]-7-(4-methylpiperazin-1-yl)quinolin-4-one.
| Compound Name | 6,8-difluoro-1-(2-fluoroethyl)-3-[3-(4-methoxyphenyl)prop-2-enoyl]-7-(4-methylpiperazin-1-yl)quinolin-4-one |
|---|---|
| PubChem CID | 175029806 |
| Molecular Formula | C26H26F3N3O3 |
| Molecular Weight | 485.51 g/mol |
| Exact Mass | 485.19 |
| IUPAC Name | 6,8-difluoro-1-(2-fluoroethyl)-3-[3-(4-methoxyphenyl)prop-2-enoyl]-7-(4-methylpiperazin-1-yl)quinolin-4-one |
| SMILES | COc1ccc(C=CC(=O)c2cn(CCF)c3c(F)c(N4CCN(C)CC4)c(F)cc3c2=O)cc1 |
| InChI | InChI=1S/C26H26F3N3O3/c1-30-11-13-31(14-12-30)25-21(28)15-19-24(23(25)29)32(10-9-27)16-20(26(19)34)22(33)8-5-17-3-6-18(35-2)7-4-17/h3-8,15-16H,9-14H2,1-2H3 |
| InChIKey | QQLMMFYATUNBLI-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 54.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.51 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|