C25H26F2N4O5 — CID 5482130
1-ethyl-6,8-difluoro-7-[4-[(2E)-2-hydroxyimino-2-(4-methoxyphenyl)ethyl]piperazin-1-yl]-4-oxoquinoline-3-carboxylic acid (PubChem CID 5482130) has the molecular formula C25H26F2N4O5 and a molecular weight of 500.50 g/mol. Its IUPAC name is 1-ethyl-6,8-difluoro-7-[4-[(2E)-2-hydroxyimino-2-(4-methoxyphenyl)ethyl]piperazin-1-yl]-4-oxoquinoline-3-carboxylic acid.
| Compound Name | 1-ethyl-6,8-difluoro-7-[4-[(2E)-2-hydroxyimino-2-(4-methoxyphenyl)ethyl]piperazin-1-yl]-4-oxoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 5482130 |
| Molecular Formula | C25H26F2N4O5 |
| Molecular Weight | 500.50 g/mol |
| Exact Mass | 500.19 |
| IUPAC Name | 1-ethyl-6,8-difluoro-7-[4-[(2E)-2-hydroxyimino-2-(4-methoxyphenyl)ethyl]piperazin-1-yl]-4-oxoquinoline-3-carboxylic acid |
| SMILES | CCn1cc(C(=O)O)c(=O)c2cc(F)c(N3CCN(C/C(=N/O)c4ccc(OC)cc4)CC3)c(F)c21 |
| InChI | InChI=1S/C25H26F2N4O5/c1-3-30-13-18(25(33)34)24(32)17-12-19(26)23(21(27)22(17)30)31-10-8-29(9-11-31)14-20(28-35)15-4-6-16(36-2)7-5-15/h4-7,12-13,35H,3,8-11,14H2,1-2H3,(H,33,34)/b28-20- |
| InChIKey | DQSXZZFICXWGMH-RRAHZORUSA-N |
| XLogP | 3.01 |
| TPSA | 107.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.50 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|