C19H22F2N4O4 — CID 71567533
1-ethyl-6,8-difluoro-7-[(3E)-3-methoxyimino-4-(methylamino)piperidin-1-yl]-4-oxoquinoline-3-carboxylic acid (PubChem CID 71567533) has the molecular formula C19H22F2N4O4 and a molecular weight of 408.41 g/mol. Its IUPAC name is 1-ethyl-6,8-difluoro-7-[(3E)-3-methoxyimino-4-(methylamino)piperidin-1-yl]-4-oxoquinoline-3-carboxylic acid.
| Compound Name | 1-ethyl-6,8-difluoro-7-[(3E)-3-methoxyimino-4-(methylamino)piperidin-1-yl]-4-oxoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 71567533 |
| Molecular Formula | C19H22F2N4O4 |
| Molecular Weight | 408.41 g/mol |
| Exact Mass | 408.16 |
| IUPAC Name | 1-ethyl-6,8-difluoro-7-[(3E)-3-methoxyimino-4-(methylamino)piperidin-1-yl]-4-oxoquinoline-3-carboxylic acid |
| SMILES | CCn1cc(C(=O)O)c(=O)c2cc(F)c(N3CCC(NC)/C(=N/OC)C3)c(F)c21 |
| InChI | InChI=1S/C19H22F2N4O4/c1-4-24-8-11(19(27)28)18(26)10-7-12(20)17(15(21)16(10)24)25-6-5-13(22-2)14(9-25)23-29-3/h7-8,13,22H,4-6,9H2,1-3H3,(H,27,28)/b23-14+ |
| InChIKey | DZZOBJVLDNUPHQ-OEAKJJBVSA-N |
| XLogP | 1.80 |
| TPSA | 96.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.41 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|