C18H18F2N4O4 — CID 101072494
7-[(3S,4Z)-3-amino-4-methoxyiminopyrrolidin-1-yl]-1-cyclopropyl-6,8-difluoro-4-oxoquinoline-3-carboxylic acid (PubChem CID 101072494) has the molecular formula C18H18F2N4O4 and a molecular weight of 392.36 g/mol. Its IUPAC name is 7-[(3S,4Z)-3-amino-4-methoxyiminopyrrolidin-1-yl]-1-cyclopropyl-6,8-difluoro-4-oxoquinoline-3-carboxylic acid.
| Compound Name | 7-[(3S,4Z)-3-amino-4-methoxyiminopyrrolidin-1-yl]-1-cyclopropyl-6,8-difluoro-4-oxoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 101072494 |
| Molecular Formula | C18H18F2N4O4 |
| Molecular Weight | 392.36 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | 7-[(3S,4Z)-3-amino-4-methoxyiminopyrrolidin-1-yl]-1-cyclopropyl-6,8-difluoro-4-oxoquinoline-3-carboxylic acid |
| SMILES | CO/N=C1/CN(c2c(F)cc3c(=O)c(C(=O)O)cn(C4CC4)c3c2F)C[C@@H]1N |
| InChI | InChI=1S/C18H18F2N4O4/c1-28-22-13-7-23(6-12(13)21)16-11(19)4-9-15(14(16)20)24(8-2-3-8)5-10(17(9)25)18(26)27/h4-5,8,12H,2-3,6-7,21H2,1H3,(H,26,27)/b22-13-/t12-/m0/s1 |
| InChIKey | IIFXHPSLPRGQQO-CJVAQADSSA-N |
| XLogP | 1.46 |
| TPSA | 110.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.36 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|