C21H25FN4O5 — CID 54583688
7-[(4E)-3-(aminomethyl)-4-methoxyiminopiperidin-1-yl]-1-cyclopropyl-6-fluoro-8-methoxy-4-oxoquinoline-3-carboxylic acid (PubChem CID 54583688) has the molecular formula C21H25FN4O5 and a molecular weight of 432.45 g/mol. Its IUPAC name is 7-[(4E)-3-(aminomethyl)-4-methoxyiminopiperidin-1-yl]-1-cyclopropyl-6-fluoro-8-methoxy-4-oxoquinoline-3-carboxylic acid.
| Compound Name | 7-[(4E)-3-(aminomethyl)-4-methoxyiminopiperidin-1-yl]-1-cyclopropyl-6-fluoro-8-methoxy-4-oxoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 54583688 |
| Molecular Formula | C21H25FN4O5 |
| Molecular Weight | 432.45 g/mol |
| Exact Mass | 432.18 |
| IUPAC Name | 7-[(4E)-3-(aminomethyl)-4-methoxyiminopiperidin-1-yl]-1-cyclopropyl-6-fluoro-8-methoxy-4-oxoquinoline-3-carboxylic acid |
| SMILES | CO/N=C1\CCN(c2c(F)cc3c(=O)c(C(=O)O)cn(C4CC4)c3c2OC)CC1CN |
| InChI | InChI=1S/C21H25FN4O5/c1-30-20-17-13(19(27)14(21(28)29)10-26(17)12-3-4-12)7-15(22)18(20)25-6-5-16(24-31-2)11(8-23)9-25/h7,10-12H,3-6,8-9,23H2,1-2H3,(H,28,29)/b24-16+ |
| InChIKey | HSXJSBYTWJPLSR-LFVJCYFKSA-N |
| XLogP | 1.97 |
| TPSA | 119.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.45 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|