C28H31FN4O7 — CID 86573282
7-[(4Z)-3-amino-4-[(2,3-dimethoxyphenyl)methoxyimino]piperidin-1-yl]-1-cyclopropyl-6-fluoro-8-methoxy-4-oxoquinoline-3-carboxylic acid (PubChem CID 86573282) has the molecular formula C28H31FN4O7 and a molecular weight of 554.58 g/mol. Its IUPAC name is 7-[(4Z)-3-amino-4-[(2,3-dimethoxyphenyl)methoxyimino]piperidin-1-yl]-1-cyclopropyl-6-fluoro-8-methoxy-4-oxoquinoline-3-carboxylic acid.
| Compound Name | 7-[(4Z)-3-amino-4-[(2,3-dimethoxyphenyl)methoxyimino]piperidin-1-yl]-1-cyclopropyl-6-fluoro-8-methoxy-4-oxoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 86573282 |
| Molecular Formula | C28H31FN4O7 |
| Molecular Weight | 554.58 g/mol |
| Exact Mass | 554.22 |
| IUPAC Name | 7-[(4Z)-3-amino-4-[(2,3-dimethoxyphenyl)methoxyimino]piperidin-1-yl]-1-cyclopropyl-6-fluoro-8-methoxy-4-oxoquinoline-3-carboxylic acid |
| SMILES | COc1cccc(CO/N=C2/CCN(c3c(F)cc4c(=O)c(C(=O)O)cn(C5CC5)c4c3OC)CC2N)c1OC |
| InChI | InChI=1S/C28H31FN4O7/c1-37-22-6-4-5-15(26(22)38-2)14-40-31-21-9-10-32(13-20(21)30)24-19(29)11-17-23(27(24)39-3)33(16-7-8-16)12-18(25(17)34)28(35)36/h4-6,11-12,16,20H,7-10,13-14,30H2,1-3H3,(H,35,36)/b31-21- |
| InChIKey | JSHRHPCGCUNBMK-YQYKVWLJSA-N |
| XLogP | 3.31 |
| TPSA | 137.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.58 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|