C21H23F2N5O5 — CID 52944993
1-cyclopropyl-7-[(3Z)-3-ethoxyimino-4-[(E)-N'-methoxycarbamimidoyl]pyrrolidin-1-yl]-6,8-difluoro-4-oxoquinoline-3-carboxylic acid (PubChem CID 52944993) has the molecular formula C21H23F2N5O5 and a molecular weight of 463.44 g/mol. Its IUPAC name is 1-cyclopropyl-7-[(3Z)-3-ethoxyimino-4-[(E)-N'-methoxycarbamimidoyl]pyrrolidin-1-yl]-6,8-difluoro-4-oxoquinoline-3-carboxylic acid.
| Compound Name | 1-cyclopropyl-7-[(3Z)-3-ethoxyimino-4-[(E)-N'-methoxycarbamimidoyl]pyrrolidin-1-yl]-6,8-difluoro-4-oxoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 52944993 |
| Molecular Formula | C21H23F2N5O5 |
| Molecular Weight | 463.44 g/mol |
| Exact Mass | 463.17 |
| IUPAC Name | 1-cyclopropyl-7-[(3Z)-3-ethoxyimino-4-[(E)-N'-methoxycarbamimidoyl]pyrrolidin-1-yl]-6,8-difluoro-4-oxoquinoline-3-carboxylic acid |
| SMILES | CCO/N=C1\CN(c2c(F)cc3c(=O)c(C(=O)O)cn(C4CC4)c3c2F)CC1/C(N)=N\OC |
| InChI | InChI=1S/C21H23F2N5O5/c1-3-33-25-15-9-27(7-12(15)20(24)26-32-2)18-14(22)6-11-17(16(18)23)28(10-4-5-10)8-13(19(11)29)21(30)31/h6,8,10,12H,3-5,7,9H2,1-2H3,(H2,24,26)(H,30,31)/b25-15+ |
| InChIKey | FVOMHLRDTDGMAV-MFKUBSTISA-N |
| XLogP | 2.06 |
| TPSA | 131.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.44 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|