C22H26F2N4O4 — CID 46934293
7-[(4Z)-3-(aminomethyl)-4-ethoxyimino-3-methylpiperidin-1-yl]-1-cyclopropyl-6,8-difluoro-4-oxoquinoline-3-carboxylic acid (PubChem CID 46934293) has the molecular formula C22H26F2N4O4 and a molecular weight of 448.47 g/mol. Its IUPAC name is 7-[(4Z)-3-(aminomethyl)-4-ethoxyimino-3-methylpiperidin-1-yl]-1-cyclopropyl-6,8-difluoro-4-oxoquinoline-3-carboxylic acid.
| Compound Name | 7-[(4Z)-3-(aminomethyl)-4-ethoxyimino-3-methylpiperidin-1-yl]-1-cyclopropyl-6,8-difluoro-4-oxoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 46934293 |
| Molecular Formula | C22H26F2N4O4 |
| Molecular Weight | 448.47 g/mol |
| Exact Mass | 448.19 |
| IUPAC Name | 7-[(4Z)-3-(aminomethyl)-4-ethoxyimino-3-methylpiperidin-1-yl]-1-cyclopropyl-6,8-difluoro-4-oxoquinoline-3-carboxylic acid |
| SMILES | CCO/N=C1/CCN(c2c(F)cc3c(=O)c(C(=O)O)cn(C4CC4)c3c2F)CC1(C)CN |
| InChI | InChI=1S/C22H26F2N4O4/c1-3-32-26-16-6-7-27(11-22(16,2)10-25)19-15(23)8-13-18(17(19)24)28(12-4-5-12)9-14(20(13)29)21(30)31/h8-9,12H,3-7,10-11,25H2,1-2H3,(H,30,31)/b26-16- |
| InChIKey | ZIZOWESAVARYKT-QQXSKIMKSA-N |
| XLogP | 2.88 |
| TPSA | 110.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.47 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|