C20H22FN5O6 — CID 52943580
(2S)-6-[(3Z)-3-ethoxyimino-4-[(E)-N'-hydroxycarbamimidoyl]pyrrolidin-1-yl]-7-fluoro-2-methyl-10-oxo-4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8,11-tetraene-11-carboxylic acid (PubChem CID 52943580) has the molecular formula C20H22FN5O6 and a molecular weight of 447.42 g/mol. Its IUPAC name is (2S)-6-[(3Z)-3-ethoxyimino-4-[(E)-N'-hydroxycarbamimidoyl]pyrrolidin-1-yl]-7-fluoro-2-methyl-10-oxo-4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8,11-tetraene-11-carboxylic acid.
| Compound Name | (2S)-6-[(3Z)-3-ethoxyimino-4-[(E)-N'-hydroxycarbamimidoyl]pyrrolidin-1-yl]-7-fluoro-2-methyl-10-oxo-4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8,11-tetraene-11-carboxylic acid |
|---|---|
| PubChem CID | 52943580 |
| Molecular Formula | C20H22FN5O6 |
| Molecular Weight | 447.42 g/mol |
| Exact Mass | 447.16 |
| IUPAC Name | (2S)-6-[(3Z)-3-ethoxyimino-4-[(E)-N'-hydroxycarbamimidoyl]pyrrolidin-1-yl]-7-fluoro-2-methyl-10-oxo-4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8,11-tetraene-11-carboxylic acid |
| SMILES | CCO/N=C1\CN(c2c(F)cc3c(=O)c(C(=O)O)cn4c3c2OC[C@@H]4C)CC1/C(N)=N\O |
| InChI | InChI=1S/C20H22FN5O6/c1-3-32-24-14-7-25(5-11(14)19(22)23-30)16-13(21)4-10-15-18(16)31-8-9(2)26(15)6-12(17(10)27)20(28)29/h4,6,9,11,30H,3,5,7-8H2,1-2H3,(H2,22,23)(H,28,29)/b24-14+/t9-,11?/m0/s1 |
| InChIKey | PMUOBNJRNZOSFA-SSFJZVQISA-N |
| XLogP | 1.37 |
| TPSA | 151.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.42 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|