C23H23FN4O3 — CID 175146812
1-ethyl-6-fluoro-3-[3-(4-hydroxyphenyl)prop-2-enoyl]-7-piperazin-1-yl-1,8-naphthyridin-4-one (PubChem CID 175146812) has the molecular formula C23H23FN4O3 and a molecular weight of 422.46 g/mol. Its IUPAC name is 1-ethyl-6-fluoro-3-[3-(4-hydroxyphenyl)prop-2-enoyl]-7-piperazin-1-yl-1,8-naphthyridin-4-one.
| Compound Name | 1-ethyl-6-fluoro-3-[3-(4-hydroxyphenyl)prop-2-enoyl]-7-piperazin-1-yl-1,8-naphthyridin-4-one |
|---|---|
| PubChem CID | 175146812 |
| Molecular Formula | C23H23FN4O3 |
| Molecular Weight | 422.46 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | 1-ethyl-6-fluoro-3-[3-(4-hydroxyphenyl)prop-2-enoyl]-7-piperazin-1-yl-1,8-naphthyridin-4-one |
| SMILES | CCn1cc(C(=O)C=Cc2ccc(O)cc2)c(=O)c2cc(F)c(N3CCNCC3)nc21 |
| InChI | InChI=1S/C23H23FN4O3/c1-2-27-14-18(20(30)8-5-15-3-6-16(29)7-4-15)21(31)17-13-19(24)23(26-22(17)27)28-11-9-25-10-12-28/h3-8,13-14,25,29H,2,9-12H2,1H3 |
| InChIKey | ICIVNVDIBJTQQI-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.46 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|