C25H23FN4O3 — CID 25228872
naphthalen-2-yl 1-ethyl-6-fluoro-4-oxo-7-piperazin-1-yl-1,8-naphthyridine-3-carboxylate (PubChem CID 25228872) has the molecular formula C25H23FN4O3 and a molecular weight of 446.48 g/mol. Its IUPAC name is naphthalen-2-yl 1-ethyl-6-fluoro-4-oxo-7-piperazin-1-yl-1,8-naphthyridine-3-carboxylate.
| Compound Name | naphthalen-2-yl 1-ethyl-6-fluoro-4-oxo-7-piperazin-1-yl-1,8-naphthyridine-3-carboxylate |
|---|---|
| PubChem CID | 25228872 |
| Molecular Formula | C25H23FN4O3 |
| Molecular Weight | 446.48 g/mol |
| Exact Mass | 446.18 |
| IUPAC Name | naphthalen-2-yl 1-ethyl-6-fluoro-4-oxo-7-piperazin-1-yl-1,8-naphthyridine-3-carboxylate |
| SMILES | CCn1cc(C(=O)Oc2ccc3ccccc3c2)c(=O)c2cc(F)c(N3CCNCC3)nc21 |
| InChI | InChI=1S/C25H23FN4O3/c1-2-29-15-20(25(32)33-18-8-7-16-5-3-4-6-17(16)13-18)22(31)19-14-21(26)24(28-23(19)29)30-11-9-27-10-12-30/h3-8,13-15,27H,2,9-12H2,1H3 |
| InChIKey | VJQIJQYPLOMGQA-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.48 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|