C27H28FN3O4 — CID 175132720
1-cyclopropyl-6-fluoro-3-[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]-8-methoxy-7-(3-methylpiperazin-1-yl)quinolin-4-one (PubChem CID 175132720) has the molecular formula C27H28FN3O4 and a molecular weight of 477.54 g/mol. Its IUPAC name is 1-cyclopropyl-6-fluoro-3-[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]-8-methoxy-7-(3-methylpiperazin-1-yl)quinolin-4-one.
| Compound Name | 1-cyclopropyl-6-fluoro-3-[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]-8-methoxy-7-(3-methylpiperazin-1-yl)quinolin-4-one |
|---|---|
| PubChem CID | 175132720 |
| Molecular Formula | C27H28FN3O4 |
| Molecular Weight | 477.54 g/mol |
| Exact Mass | 477.21 |
| IUPAC Name | 1-cyclopropyl-6-fluoro-3-[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]-8-methoxy-7-(3-methylpiperazin-1-yl)quinolin-4-one |
| SMILES | COc1c(N2CCNC(C)C2)c(F)cc2c(=O)c(C(=O)/C=C/c3ccc(O)cc3)cn(C3CC3)c12 |
| InChI | InChI=1S/C27H28FN3O4/c1-16-14-30(12-11-29-16)25-22(28)13-20-24(27(25)35-2)31(18-6-7-18)15-21(26(20)34)23(33)10-5-17-3-8-19(32)9-4-17/h3-5,8-10,13,15-16,18,29,32H,6-7,11-12,14H2,1-2H3/b10-5+ |
| InChIKey | KPPBLKNTUMTBSP-BJMVGYQFSA-N |
| XLogP | 3.88 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.54 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|