C21H24FN3O6 — CID 144698365
formyloxymethyl 1-cyclopropyl-6-fluoro-8-methoxy-7-(3-methylpiperazin-1-yl)-4-oxoquinoline-3-carboxylate (PubChem CID 144698365) has the molecular formula C21H24FN3O6 and a molecular weight of 433.44 g/mol. Its IUPAC name is formyloxymethyl 1-cyclopropyl-6-fluoro-8-methoxy-7-(3-methylpiperazin-1-yl)-4-oxoquinoline-3-carboxylate.
| Compound Name | formyloxymethyl 1-cyclopropyl-6-fluoro-8-methoxy-7-(3-methylpiperazin-1-yl)-4-oxoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 144698365 |
| Molecular Formula | C21H24FN3O6 |
| Molecular Weight | 433.44 g/mol |
| Exact Mass | 433.16 |
| IUPAC Name | formyloxymethyl 1-cyclopropyl-6-fluoro-8-methoxy-7-(3-methylpiperazin-1-yl)-4-oxoquinoline-3-carboxylate |
| SMILES | COc1c(N2CCNC(C)C2)c(F)cc2c(=O)c(C(=O)OCOC=O)cn(C3CC3)c12 |
| InChI | InChI=1S/C21H24FN3O6/c1-12-8-24(6-5-23-12)18-16(22)7-14-17(20(18)29-2)25(13-3-4-13)9-15(19(14)27)21(28)31-11-30-10-26/h7,9-10,12-13,23H,3-6,8,11H2,1-2H3 |
| InChIKey | USBYKJDFOFIHAC-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.44 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|