C23H32FN3O8P2 — CID 143406793
[4-[1-cyclopropyl-6-fluoro-8-methoxy-7-(3-methylpiperazin-1-yl)-4-oxoquinoline-3-carbonyl]oxy-1-dihydroxyphosphanylbutyl]phosphonous acid (PubChem CID 143406793) has the molecular formula C23H32FN3O8P2 and a molecular weight of 559.47 g/mol. Its IUPAC name is [4-[1-cyclopropyl-6-fluoro-8-methoxy-7-(3-methylpiperazin-1-yl)-4-oxoquinoline-3-carbonyl]oxy-1-dihydroxyphosphanylbutyl]phosphonous acid.
| Compound Name | [4-[1-cyclopropyl-6-fluoro-8-methoxy-7-(3-methylpiperazin-1-yl)-4-oxoquinoline-3-carbonyl]oxy-1-dihydroxyphosphanylbutyl]phosphonous acid |
|---|---|
| PubChem CID | 143406793 |
| Molecular Formula | C23H32FN3O8P2 |
| Molecular Weight | 559.47 g/mol |
| Exact Mass | 559.16 |
| IUPAC Name | [4-[1-cyclopropyl-6-fluoro-8-methoxy-7-(3-methylpiperazin-1-yl)-4-oxoquinoline-3-carbonyl]oxy-1-dihydroxyphosphanylbutyl]phosphonous acid |
| SMILES | COc1c(N2CCNC(C)C2)c(F)cc2c(=O)c(C(=O)OCCCC(P(O)O)P(O)O)cn(C3CC3)c12 |
| InChI | InChI=1S/C23H32FN3O8P2/c1-13-11-26(8-7-25-13)20-17(24)10-15-19(22(20)34-2)27(14-5-6-14)12-16(21(15)28)23(29)35-9-3-4-18(36(30)31)37(32)33/h10,12-14,18,25,30-33H,3-9,11H2,1-2H3 |
| InChIKey | VTJAEEXKYCZSHK-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 153.72 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.47 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|