C27H27ClFN3O3 — CID 175450363
3-[3-(4-chlorophenyl)prop-2-enoyl]-1-cyclopropyl-6-fluoro-8-methoxy-7-(3-methylpiperazin-1-yl)quinolin-4-one (PubChem CID 175450363) has the molecular formula C27H27ClFN3O3 and a molecular weight of 495.98 g/mol. Its IUPAC name is 3-[3-(4-chlorophenyl)prop-2-enoyl]-1-cyclopropyl-6-fluoro-8-methoxy-7-(3-methylpiperazin-1-yl)quinolin-4-one.
| Compound Name | 3-[3-(4-chlorophenyl)prop-2-enoyl]-1-cyclopropyl-6-fluoro-8-methoxy-7-(3-methylpiperazin-1-yl)quinolin-4-one |
|---|---|
| PubChem CID | 175450363 |
| Molecular Formula | C27H27ClFN3O3 |
| Molecular Weight | 495.98 g/mol |
| Exact Mass | 495.17 |
| IUPAC Name | 3-[3-(4-chlorophenyl)prop-2-enoyl]-1-cyclopropyl-6-fluoro-8-methoxy-7-(3-methylpiperazin-1-yl)quinolin-4-one |
| SMILES | COc1c(N2CCNC(C)C2)c(F)cc2c(=O)c(C(=O)C=Cc3ccc(Cl)cc3)cn(C3CC3)c12 |
| InChI | InChI=1S/C27H27ClFN3O3/c1-16-14-31(12-11-30-16)25-22(29)13-20-24(27(25)35-2)32(19-8-9-19)15-21(26(20)34)23(33)10-5-17-3-6-18(28)7-4-17/h3-7,10,13,15-16,19,30H,8-9,11-12,14H2,1-2H3 |
| InChIKey | YRTJJSIDMRLUKV-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.98 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|