C34H38FN3O7 — CID 175126815
7-(1-acetyl-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-6-yl)-1-cyclopropyl-6-fluoro-8-methoxy-3-[3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]quinolin-4-one (PubChem CID 175126815) has the molecular formula C34H38FN3O7 and a molecular weight of 619.69 g/mol. Its IUPAC name is 7-(1-acetyl-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-6-yl)-1-cyclopropyl-6-fluoro-8-methoxy-3-[3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]quinolin-4-one.
| Compound Name | 7-(1-acetyl-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-6-yl)-1-cyclopropyl-6-fluoro-8-methoxy-3-[3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]quinolin-4-one |
|---|---|
| PubChem CID | 175126815 |
| Molecular Formula | C34H38FN3O7 |
| Molecular Weight | 619.69 g/mol |
| Exact Mass | 619.27 |
| IUPAC Name | 7-(1-acetyl-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-6-yl)-1-cyclopropyl-6-fluoro-8-methoxy-3-[3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]quinolin-4-one |
| SMILES | COc1cc(C=CC(=O)c2cn(C3CC3)c3c(OC)c(N4CC5CCCN(C(C)=O)C5C4)c(F)cc3c2=O)cc(OC)c1OC |
| InChI | InChI=1S/C34H38FN3O7/c1-19(39)37-12-6-7-21-16-36(18-26(21)37)31-25(35)15-23-30(34(31)45-5)38(22-9-10-22)17-24(32(23)41)27(40)11-8-20-13-28(42-2)33(44-4)29(14-20)43-3/h8,11,13-15,17,21-22,26H,6-7,9-10,12,16,18H2,1-5H3 |
| InChIKey | LPUZWUHQBDGSMJ-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 99.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.69 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|