C26H33FN3O6+ — CID 163960103
[7-[(4aS,7aS)-1-[(2-methylpropan-2-yl)oxycarbonyl]-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-6-yl]-1-cyclopropyl-6-fluoro-8-methoxy-4-oxoquinoline-3-carbonyl]oxidanium (PubChem CID 163960103) has the molecular formula C26H33FN3O6+ and a molecular weight of 502.56 g/mol. Its IUPAC name is [7-[(4aS,7aS)-1-[(2-methylpropan-2-yl)oxycarbonyl]-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-6-yl]-1-cyclopropyl-6-fluoro-8-methoxy-4-oxoquinoline-3-carbonyl]oxidanium.
| Compound Name | [7-[(4aS,7aS)-1-[(2-methylpropan-2-yl)oxycarbonyl]-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-6-yl]-1-cyclopropyl-6-fluoro-8-methoxy-4-oxoquinoline-3-carbonyl]oxidanium |
|---|---|
| PubChem CID | 163960103 |
| Molecular Formula | C26H33FN3O6+ |
| Molecular Weight | 502.56 g/mol |
| Exact Mass | 502.23 |
| IUPAC Name | [7-[(4aS,7aS)-1-[(2-methylpropan-2-yl)oxycarbonyl]-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-6-yl]-1-cyclopropyl-6-fluoro-8-methoxy-4-oxoquinoline-3-carbonyl]oxidanium |
| SMILES | COc1c(N2C[C@@H]3CCCN(C(=O)OC(C)(C)C)[C@@H]3C2)c(F)cc2c(=O)c(C(=O)[OH2+])cn(C3CC3)c12 |
| InChI | InChI=1S/C26H32FN3O6/c1-26(2,3)36-25(34)29-9-5-6-14-11-28(13-19(14)29)21-18(27)10-16-20(23(21)35-4)30(15-7-8-15)12-17(22(16)31)24(32)33/h10,12,14-15,19H,5-9,11,13H2,1-4H3,(H,32,33)/p+1/t14-,19+/m0/s1 |
| InChIKey | SGRZKRODBWAZGR-IFXJQAMLSA-O |
| XLogP | 3.18 |
| TPSA | 103.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.56 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|