C27H35N3O12P2 — CID 146430289
7-[(7aR)-1-(1,1-diphosphonoethoxycarbonyl)-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-6-yl]-1-cyclopropyl-8-methoxy-4-oxo-6-prop-1-en-2-ylquinoline-3-carboxylic acid (PubChem CID 146430289) has the molecular formula C27H35N3O12P2 and a molecular weight of 655.53 g/mol. Its IUPAC name is 7-[(7aR)-1-(1,1-diphosphonoethoxycarbonyl)-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-6-yl]-1-cyclopropyl-8-methoxy-4-oxo-6-prop-1-en-2-ylquinoline-3-carboxylic acid.
| Compound Name | 7-[(7aR)-1-(1,1-diphosphonoethoxycarbonyl)-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-6-yl]-1-cyclopropyl-8-methoxy-4-oxo-6-prop-1-en-2-ylquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 146430289 |
| Molecular Formula | C27H35N3O12P2 |
| Molecular Weight | 655.53 g/mol |
| Exact Mass | 655.17 |
| IUPAC Name | 7-[(7aR)-1-(1,1-diphosphonoethoxycarbonyl)-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-6-yl]-1-cyclopropyl-8-methoxy-4-oxo-6-prop-1-en-2-ylquinoline-3-carboxylic acid |
| SMILES | C=C(C)c1cc2c(=O)c(C(=O)O)cn(C3CC3)c2c(OC)c1N1CC2CCCN(C(=O)OC(C)(P(=O)(O)O)P(=O)(O)O)[C@H]2C1 |
| InChI | InChI=1S/C27H35N3O12P2/c1-14(2)17-10-18-22(30(16-7-8-16)12-19(23(18)31)25(32)33)24(41-4)21(17)28-11-15-6-5-9-29(20(15)13-28)26(34)42-27(3,43(35,36)37)44(38,39)40/h10,12,15-16,20H,1,5-9,11,13H2,2-4H3,(H,32,33)(H2,35,36,37)(H2,38,39,40)/t15?,20-/m0/s1 |
| InChIKey | ZETMCXOOQYEAEG-MBABXSBOSA-N |
| XLogP | 3.14 |
| TPSA | 216.37 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.53 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|