C29H29F2N3O3 — CID 175168735
7-(1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl)-1-cyclopropyl-6-fluoro-3-[3-(4-fluorophenyl)prop-2-enoyl]-8-methoxyquinolin-4-one (PubChem CID 175168735) has the molecular formula C29H29F2N3O3 and a molecular weight of 505.57 g/mol. Its IUPAC name is 7-(1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl)-1-cyclopropyl-6-fluoro-3-[3-(4-fluorophenyl)prop-2-enoyl]-8-methoxyquinolin-4-one.
| Compound Name | 7-(1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl)-1-cyclopropyl-6-fluoro-3-[3-(4-fluorophenyl)prop-2-enoyl]-8-methoxyquinolin-4-one |
|---|---|
| PubChem CID | 175168735 |
| Molecular Formula | C29H29F2N3O3 |
| Molecular Weight | 505.57 g/mol |
| Exact Mass | 505.22 |
| IUPAC Name | 7-(1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl)-1-cyclopropyl-6-fluoro-3-[3-(4-fluorophenyl)prop-2-enoyl]-8-methoxyquinolin-4-one |
| SMILES | COc1c(N2CC3CCCNC3C2)c(F)cc2c(=O)c(C(=O)C=Cc3ccc(F)cc3)cn(C3CC3)c12 |
| InChI | InChI=1S/C29H29F2N3O3/c1-37-29-26-21(13-23(31)27(29)33-14-18-3-2-12-32-24(18)16-33)28(36)22(15-34(26)20-9-10-20)25(35)11-6-17-4-7-19(30)8-5-17/h4-8,11,13,15,18,20,24,32H,2-3,9-10,12,14,16H2,1H3 |
| InChIKey | SLLXJZOQBPJWJE-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.57 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|