C25H33FN4O3 — CID 24952109
7-(1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl)-1-cyclopropyl-N,N-diethyl-6-fluoro-8-methoxy-4-oxoquinoline-3-carboxamide (PubChem CID 24952109) has the molecular formula C25H33FN4O3 and a molecular weight of 456.56 g/mol. Its IUPAC name is 7-(1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl)-1-cyclopropyl-N,N-diethyl-6-fluoro-8-methoxy-4-oxoquinoline-3-carboxamide.
| Compound Name | 7-(1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl)-1-cyclopropyl-N,N-diethyl-6-fluoro-8-methoxy-4-oxoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 24952109 |
| Molecular Formula | C25H33FN4O3 |
| Molecular Weight | 456.56 g/mol |
| Exact Mass | 456.25 |
| IUPAC Name | 7-(1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl)-1-cyclopropyl-N,N-diethyl-6-fluoro-8-methoxy-4-oxoquinoline-3-carboxamide |
| SMILES | CCN(CC)C(=O)c1cn(C2CC2)c2c(OC)c(N3CC4CCCNC4C3)c(F)cc2c1=O |
| InChI | InChI=1S/C25H33FN4O3/c1-4-28(5-2)25(32)18-13-30(16-8-9-16)21-17(23(18)31)11-19(26)22(24(21)33-3)29-12-15-7-6-10-27-20(15)14-29/h11,13,15-16,20,27H,4-10,12,14H2,1-3H3 |
| InChIKey | XISDVHCGWDCFFK-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 66.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.56 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |