C30H35FN6O3 — CID 171341582
7-(1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl)-1-cyclopropyl-N-[(E)-[4-(dimethylamino)phenyl]methylideneamino]-6-fluoro-8-methoxy-4-oxoquinoline-3-carboxamide (PubChem CID 171341582) has the molecular formula C30H35FN6O3 and a molecular weight of 546.65 g/mol. Its IUPAC name is 7-(1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl)-1-cyclopropyl-N-[(E)-[4-(dimethylamino)phenyl]methylideneamino]-6-fluoro-8-methoxy-4-oxoquinoline-3-carboxamide.
| Compound Name | 7-(1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl)-1-cyclopropyl-N-[(E)-[4-(dimethylamino)phenyl]methylideneamino]-6-fluoro-8-methoxy-4-oxoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 171341582 |
| Molecular Formula | C30H35FN6O3 |
| Molecular Weight | 546.65 g/mol |
| Exact Mass | 546.28 |
| IUPAC Name | 7-(1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl)-1-cyclopropyl-N-[(E)-[4-(dimethylamino)phenyl]methylideneamino]-6-fluoro-8-methoxy-4-oxoquinoline-3-carboxamide |
| SMILES | COc1c(N2CC3CCCNC3C2)c(F)cc2c(=O)c(C(=O)N/N=C/c3ccc(N(C)C)cc3)cn(C3CC3)c12 |
| InChI | InChI=1S/C30H35FN6O3/c1-35(2)20-8-6-18(7-9-20)14-33-34-30(39)23-16-37(21-10-11-21)26-22(28(23)38)13-24(31)27(29(26)40-3)36-15-19-5-4-12-32-25(19)17-36/h6-9,13-14,16,19,21,25,32H,4-5,10-12,15,17H2,1-3H3,(H,34,39)/b33-14+ |
| InChIKey | GRINOZHTXDZMGY-ZHSUKTGHSA-N |
| XLogP | 3.50 |
| TPSA | 91.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.65 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|