C26H28FN5O4 — CID 171365014
7-(1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl)-1-cyclopropyl-6-fluoro-N-[(E)-furan-3-ylmethylideneamino]-8-methoxy-4-oxoquinoline-3-carboxamide (PubChem CID 171365014) has the molecular formula C26H28FN5O4 and a molecular weight of 493.54 g/mol. Its IUPAC name is 7-(1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl)-1-cyclopropyl-6-fluoro-N-[(E)-furan-3-ylmethylideneamino]-8-methoxy-4-oxoquinoline-3-carboxamide.
| Compound Name | 7-(1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl)-1-cyclopropyl-6-fluoro-N-[(E)-furan-3-ylmethylideneamino]-8-methoxy-4-oxoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 171365014 |
| Molecular Formula | C26H28FN5O4 |
| Molecular Weight | 493.54 g/mol |
| Exact Mass | 493.21 |
| IUPAC Name | 7-(1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl)-1-cyclopropyl-6-fluoro-N-[(E)-furan-3-ylmethylideneamino]-8-methoxy-4-oxoquinoline-3-carboxamide |
| SMILES | COc1c(N2CC3CCCNC3C2)c(F)cc2c(=O)c(C(=O)N/N=C/c3ccoc3)cn(C3CC3)c12 |
| InChI | InChI=1S/C26H28FN5O4/c1-35-25-22-18(9-20(27)23(25)31-11-16-3-2-7-28-21(16)13-31)24(33)19(12-32(22)17-4-5-17)26(34)30-29-10-15-6-8-36-14-15/h6,8-10,12,14,16-17,21,28H,2-5,7,11,13H2,1H3,(H,30,34)/b29-10+ |
| InChIKey | FPPFJKOEQVQUBW-VYVUJPJFSA-N |
| XLogP | 3.03 |
| TPSA | 101.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.54 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|