C30H35FN4O11P2 — CID 59845573
[[4-[[2-[7-(1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl)-1-cyclopropyl-6-fluoro-8-methoxy-4-oxoquinoline-3-carbonyl]oxyacetyl]amino]phenyl]-phosphonomethyl]phosphonic acid (PubChem CID 59845573) has the molecular formula C30H35FN4O11P2 and a molecular weight of 708.57 g/mol. Its IUPAC name is [[4-[[2-[7-(1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl)-1-cyclopropyl-6-fluoro-8-methoxy-4-oxoquinoline-3-carbonyl]oxyacetyl]amino]phenyl]-phosphonomethyl]phosphonic acid.
| Compound Name | [[4-[[2-[7-(1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl)-1-cyclopropyl-6-fluoro-8-methoxy-4-oxoquinoline-3-carbonyl]oxyacetyl]amino]phenyl]-phosphonomethyl]phosphonic acid |
|---|---|
| PubChem CID | 59845573 |
| Molecular Formula | C30H35FN4O11P2 |
| Molecular Weight | 708.57 g/mol |
| Exact Mass | 708.18 |
| IUPAC Name | [[4-[[2-[7-(1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl)-1-cyclopropyl-6-fluoro-8-methoxy-4-oxoquinoline-3-carbonyl]oxyacetyl]amino]phenyl]-phosphonomethyl]phosphonic acid |
| SMILES | COc1c(N2CC3CCCNC3C2)c(F)cc2c(=O)c(C(=O)OCC(=O)Nc3ccc(C(P(=O)(O)O)P(=O)(O)O)cc3)cn(C3CC3)c12 |
| InChI | InChI=1S/C30H35FN4O11P2/c1-45-28-25-20(11-22(31)26(28)34-12-17-3-2-10-32-23(17)14-34)27(37)21(13-35(25)19-8-9-19)29(38)46-15-24(36)33-18-6-4-16(5-7-18)30(47(39,40)41)48(42,43)44/h4-7,11,13,17,19,23,30,32H,2-3,8-10,12,14-15H2,1H3,(H,33,36)(H2,39,40,41)(H2,42,43,44) |
| InChIKey | KIKLRSYJXCAHII-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 216.96 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.57 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|