C29H31FN3O8P — CID 59845440
[1-[4-[7-(1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl)-1-cyclopropyl-6-fluoro-8-methoxy-4-oxoquinoline-3-carbonyl]oxyphenyl]-2-oxoethyl]phosphonic acid (PubChem CID 59845440) has the molecular formula C29H31FN3O8P and a molecular weight of 599.55 g/mol. Its IUPAC name is [1-[4-[7-(1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl)-1-cyclopropyl-6-fluoro-8-methoxy-4-oxoquinoline-3-carbonyl]oxyphenyl]-2-oxoethyl]phosphonic acid.
| Compound Name | [1-[4-[7-(1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl)-1-cyclopropyl-6-fluoro-8-methoxy-4-oxoquinoline-3-carbonyl]oxyphenyl]-2-oxoethyl]phosphonic acid |
|---|---|
| PubChem CID | 59845440 |
| Molecular Formula | C29H31FN3O8P |
| Molecular Weight | 599.55 g/mol |
| Exact Mass | 599.18 |
| IUPAC Name | [1-[4-[7-(1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl)-1-cyclopropyl-6-fluoro-8-methoxy-4-oxoquinoline-3-carbonyl]oxyphenyl]-2-oxoethyl]phosphonic acid |
| SMILES | COc1c(N2CC3CCCNC3C2)c(F)cc2c(=O)c(C(=O)Oc3ccc(C(C=O)P(=O)(O)O)cc3)cn(C3CC3)c12 |
| InChI | InChI=1S/C29H31FN3O8P/c1-40-28-25-20(11-22(30)26(28)32-12-17-3-2-10-31-23(17)14-32)27(35)21(13-33(25)18-6-7-18)29(36)41-19-8-4-16(5-9-19)24(15-34)42(37,38)39/h4-5,8-9,11,13,15,17-18,23-24,31H,2-3,6-7,10,12,14H2,1H3,(H2,37,38,39) |
| InChIKey | IGCHSIXPHBXZMO-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 147.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.55 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|