C25H23ClF3N3O2 — CID 175341523
3-[(E)-3-(4-chlorophenyl)prop-2-enoyl]-6,8-difluoro-1-(2-fluoroethyl)-7-(4-methylpiperazin-1-yl)quinolin-4-one (PubChem CID 175341523) has the molecular formula C25H23ClF3N3O2 and a molecular weight of 489.93 g/mol. Its IUPAC name is 3-[(E)-3-(4-chlorophenyl)prop-2-enoyl]-6,8-difluoro-1-(2-fluoroethyl)-7-(4-methylpiperazin-1-yl)quinolin-4-one.
| Compound Name | 3-[(E)-3-(4-chlorophenyl)prop-2-enoyl]-6,8-difluoro-1-(2-fluoroethyl)-7-(4-methylpiperazin-1-yl)quinolin-4-one |
|---|---|
| PubChem CID | 175341523 |
| Molecular Formula | C25H23ClF3N3O2 |
| Molecular Weight | 489.93 g/mol |
| Exact Mass | 489.14 |
| IUPAC Name | 3-[(E)-3-(4-chlorophenyl)prop-2-enoyl]-6,8-difluoro-1-(2-fluoroethyl)-7-(4-methylpiperazin-1-yl)quinolin-4-one |
| SMILES | CN1CCN(c2c(F)cc3c(=O)c(C(=O)/C=C/c4ccc(Cl)cc4)cn(CCF)c3c2F)CC1 |
| InChI | InChI=1S/C25H23ClF3N3O2/c1-30-10-12-31(13-11-30)24-20(28)14-18-23(22(24)29)32(9-8-27)15-19(25(18)34)21(33)7-4-16-2-5-17(26)6-3-16/h2-7,14-15H,8-13H2,1H3/b7-4+ |
| InChIKey | LSAPGRLUDRXYDN-QPJJXVBHSA-N |
| XLogP | 4.55 |
| TPSA | 45.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.93 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|