C24H21F3N4O4 — CID 175030582
6,8-difluoro-1-(2-fluoroethyl)-3-[(E)-3-(4-nitrophenyl)prop-2-enoyl]-7-piperazin-1-ylquinolin-4-one (PubChem CID 175030582) has the molecular formula C24H21F3N4O4 and a molecular weight of 486.45 g/mol. Its IUPAC name is 6,8-difluoro-1-(2-fluoroethyl)-3-[(E)-3-(4-nitrophenyl)prop-2-enoyl]-7-piperazin-1-ylquinolin-4-one.
| Compound Name | 6,8-difluoro-1-(2-fluoroethyl)-3-[(E)-3-(4-nitrophenyl)prop-2-enoyl]-7-piperazin-1-ylquinolin-4-one |
|---|---|
| PubChem CID | 175030582 |
| Molecular Formula | C24H21F3N4O4 |
| Molecular Weight | 486.45 g/mol |
| Exact Mass | 486.15 |
| IUPAC Name | 6,8-difluoro-1-(2-fluoroethyl)-3-[(E)-3-(4-nitrophenyl)prop-2-enoyl]-7-piperazin-1-ylquinolin-4-one |
| SMILES | O=C(/C=C/c1ccc([N+](=O)[O-])cc1)c1cn(CCF)c2c(F)c(N3CCNCC3)c(F)cc2c1=O |
| InChI | InChI=1S/C24H21F3N4O4/c25-7-10-30-14-18(20(32)6-3-15-1-4-16(5-2-15)31(34)35)24(33)17-13-19(26)23(21(27)22(17)30)29-11-8-28-9-12-29/h1-6,13-14,28H,7-12H2/b6-3+ |
| InChIKey | LEXJDNXZAWCOLY-ZZXKWVIFSA-N |
| XLogP | 3.46 |
| TPSA | 97.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.45 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|