C24H23F2N5O5S — CID 22277660
1-ethyl-6,8-difluoro-7-[3-methyl-4-[(4-nitrophenyl)carbamothioyl]piperazin-1-yl]-4-oxoquinoline-3-carboxylic acid (PubChem CID 22277660) has the molecular formula C24H23F2N5O5S and a molecular weight of 531.54 g/mol. Its IUPAC name is 1-ethyl-6,8-difluoro-7-[3-methyl-4-[(4-nitrophenyl)carbamothioyl]piperazin-1-yl]-4-oxoquinoline-3-carboxylic acid.
| Compound Name | 1-ethyl-6,8-difluoro-7-[3-methyl-4-[(4-nitrophenyl)carbamothioyl]piperazin-1-yl]-4-oxoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 22277660 |
| Molecular Formula | C24H23F2N5O5S |
| Molecular Weight | 531.54 g/mol |
| Exact Mass | 531.14 |
| IUPAC Name | 1-ethyl-6,8-difluoro-7-[3-methyl-4-[(4-nitrophenyl)carbamothioyl]piperazin-1-yl]-4-oxoquinoline-3-carboxylic acid |
| SMILES | CCn1cc(C(=O)O)c(=O)c2cc(F)c(N3CCN(C(=S)Nc4ccc([N+](=O)[O-])cc4)C(C)C3)c(F)c21 |
| InChI | InChI=1S/C24H23F2N5O5S/c1-3-28-12-17(23(33)34)22(32)16-10-18(25)21(19(26)20(16)28)29-8-9-30(13(2)11-29)24(37)27-14-4-6-15(7-5-14)31(35)36/h4-7,10,12-13H,3,8-9,11H2,1-2H3,(H,27,37)(H,33,34) |
| InChIKey | SARBEYIBBPWUNK-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 120.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.54 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|