C26H25F2N3O7 — CID 71454017
1-ethyl-6,8-difluoro-7-[[4-[(4-nitrophenoxy)methyl]cyclohexanecarbonyl]amino]-4-oxoquinoline-3-carboxylic acid (PubChem CID 71454017) has the molecular formula C26H25F2N3O7 and a molecular weight of 529.50 g/mol. Its IUPAC name is 1-ethyl-6,8-difluoro-7-[[4-[(4-nitrophenoxy)methyl]cyclohexanecarbonyl]amino]-4-oxoquinoline-3-carboxylic acid.
| Compound Name | 1-ethyl-6,8-difluoro-7-[[4-[(4-nitrophenoxy)methyl]cyclohexanecarbonyl]amino]-4-oxoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 71454017 |
| Molecular Formula | C26H25F2N3O7 |
| Molecular Weight | 529.50 g/mol |
| Exact Mass | 529.17 |
| IUPAC Name | 1-ethyl-6,8-difluoro-7-[[4-[(4-nitrophenoxy)methyl]cyclohexanecarbonyl]amino]-4-oxoquinoline-3-carboxylic acid |
| SMILES | CCn1cc(C(=O)O)c(=O)c2cc(F)c(NC(=O)C3CCC(COc4ccc([N+](=O)[O-])cc4)CC3)c(F)c21 |
| InChI | InChI=1S/C26H25F2N3O7/c1-2-30-12-19(26(34)35)24(32)18-11-20(27)22(21(28)23(18)30)29-25(33)15-5-3-14(4-6-15)13-38-17-9-7-16(8-10-17)31(36)37/h7-12,14-15H,2-6,13H2,1H3,(H,29,33)(H,34,35) |
| InChIKey | JAIUTGUZLLRXAA-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 140.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.50 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|