C26H16F2N2O5 — CID 163696385
7-[(9,10-dioxoanthracen-2-yl)amino]-1-ethyl-6,8-difluoro-4-oxoquinoline-3-carboxylic acid (PubChem CID 163696385) has the molecular formula C26H16F2N2O5 and a molecular weight of 474.42 g/mol. Its IUPAC name is 7-[(9,10-dioxoanthracen-2-yl)amino]-1-ethyl-6,8-difluoro-4-oxoquinoline-3-carboxylic acid.
| Compound Name | 7-[(9,10-dioxoanthracen-2-yl)amino]-1-ethyl-6,8-difluoro-4-oxoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 163696385 |
| Molecular Formula | C26H16F2N2O5 |
| Molecular Weight | 474.42 g/mol |
| Exact Mass | 474.10 |
| IUPAC Name | 7-[(9,10-dioxoanthracen-2-yl)amino]-1-ethyl-6,8-difluoro-4-oxoquinoline-3-carboxylic acid |
| SMILES | CCn1cc(C(=O)O)c(=O)c2cc(F)c(Nc3ccc4c(c3)C(=O)c3ccccc3C4=O)c(F)c21 |
| InChI | InChI=1S/C26H16F2N2O5/c1-2-30-11-18(26(34)35)25(33)17-10-19(27)21(20(28)22(17)30)29-12-7-8-15-16(9-12)24(32)14-6-4-3-5-13(14)23(15)31/h3-11,29H,2H2,1H3,(H,34,35) |
| InChIKey | JXIIIYYIAVJUCA-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 105.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.42 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|