C29H32FN3O6 — CID 175354856
7-(4-acetylpiperazin-1-yl)-1-ethyl-6-fluoro-3-[3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]quinolin-4-one (PubChem CID 175354856) has the molecular formula C29H32FN3O6 and a molecular weight of 537.59 g/mol. Its IUPAC name is 7-(4-acetylpiperazin-1-yl)-1-ethyl-6-fluoro-3-[3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]quinolin-4-one.
| Compound Name | 7-(4-acetylpiperazin-1-yl)-1-ethyl-6-fluoro-3-[3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]quinolin-4-one |
|---|---|
| PubChem CID | 175354856 |
| Molecular Formula | C29H32FN3O6 |
| Molecular Weight | 537.59 g/mol |
| Exact Mass | 537.23 |
| IUPAC Name | 7-(4-acetylpiperazin-1-yl)-1-ethyl-6-fluoro-3-[3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]quinolin-4-one |
| SMILES | CCn1cc(C(=O)C=Cc2cc(OC)c(OC)c(OC)c2)c(=O)c2cc(F)c(N3CCN(C(C)=O)CC3)cc21 |
| InChI | InChI=1S/C29H32FN3O6/c1-6-31-17-21(25(35)8-7-19-13-26(37-3)29(39-5)27(14-19)38-4)28(36)20-15-22(30)24(16-23(20)31)33-11-9-32(10-12-33)18(2)34/h7-8,13-17H,6,9-12H2,1-5H3 |
| InChIKey | AEFHNFFDFJUQJY-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 90.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.59 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|