C18H19FN4O7 — CID 138393228
1-ethyl-6-fluoro-7-[4-(2-nitrooxyacetyl)piperazin-1-yl]-4-oxoquinoline-3-carboxylic acid (PubChem CID 138393228) has the molecular formula C18H19FN4O7 and a molecular weight of 422.37 g/mol. Its IUPAC name is 1-ethyl-6-fluoro-7-[4-(2-nitrooxyacetyl)piperazin-1-yl]-4-oxoquinoline-3-carboxylic acid.
| Compound Name | 1-ethyl-6-fluoro-7-[4-(2-nitrooxyacetyl)piperazin-1-yl]-4-oxoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 138393228 |
| Molecular Formula | C18H19FN4O7 |
| Molecular Weight | 422.37 g/mol |
| Exact Mass | 422.12 |
| IUPAC Name | 1-ethyl-6-fluoro-7-[4-(2-nitrooxyacetyl)piperazin-1-yl]-4-oxoquinoline-3-carboxylic acid |
| SMILES | CCn1cc(C(=O)O)c(=O)c2cc(F)c(N3CCN(C(=O)CO[N+](=O)[O-])CC3)cc21 |
| InChI | InChI=1S/C18H19FN4O7/c1-2-20-9-12(18(26)27)17(25)11-7-13(19)15(8-14(11)20)21-3-5-22(6-4-21)16(24)10-30-23(28)29/h7-9H,2-6,10H2,1H3,(H,26,27) |
| InChIKey | FPLIKYDCJBDRPL-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 135.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.37 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|