C23H20F4N4O5 — CID 166632896
1-ethyl-6-fluoro-7-[4-[4-nitro-3-(trifluoromethyl)phenyl]piperazin-1-yl]-4-oxoquinoline-3-carboxylic acid (PubChem CID 166632896) has the molecular formula C23H20F4N4O5 and a molecular weight of 508.43 g/mol. Its IUPAC name is 1-ethyl-6-fluoro-7-[4-[4-nitro-3-(trifluoromethyl)phenyl]piperazin-1-yl]-4-oxoquinoline-3-carboxylic acid.
| Compound Name | 1-ethyl-6-fluoro-7-[4-[4-nitro-3-(trifluoromethyl)phenyl]piperazin-1-yl]-4-oxoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 166632896 |
| Molecular Formula | C23H20F4N4O5 |
| Molecular Weight | 508.43 g/mol |
| Exact Mass | 508.14 |
| IUPAC Name | 1-ethyl-6-fluoro-7-[4-[4-nitro-3-(trifluoromethyl)phenyl]piperazin-1-yl]-4-oxoquinoline-3-carboxylic acid |
| SMILES | CCn1cc(C(=O)O)c(=O)c2cc(F)c(N3CCN(c4ccc([N+](=O)[O-])c(C(F)(F)F)c4)CC3)cc21 |
| InChI | InChI=1S/C23H20F4N4O5/c1-2-28-12-15(22(33)34)21(32)14-10-17(24)20(11-19(14)28)30-7-5-29(6-8-30)13-3-4-18(31(35)36)16(9-13)23(25,26)27/h3-4,9-12H,2,5-8H2,1H3,(H,33,34) |
| InChIKey | MOWKZTZWSIUIJU-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 108.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.43 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|