C22H20N6O9 — CID 54792404
7-(3,4-dimethylpiperazin-1-yl)-1-(2,4-dinitrophenyl)-6-nitro-4-oxoquinoline-3-carboxylic acid (PubChem CID 54792404) has the molecular formula C22H20N6O9 and a molecular weight of 512.44 g/mol. Its IUPAC name is 7-(3,4-dimethylpiperazin-1-yl)-1-(2,4-dinitrophenyl)-6-nitro-4-oxoquinoline-3-carboxylic acid.
| Compound Name | 7-(3,4-dimethylpiperazin-1-yl)-1-(2,4-dinitrophenyl)-6-nitro-4-oxoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 54792404 |
| Molecular Formula | C22H20N6O9 |
| Molecular Weight | 512.44 g/mol |
| Exact Mass | 512.13 |
| IUPAC Name | 7-(3,4-dimethylpiperazin-1-yl)-1-(2,4-dinitrophenyl)-6-nitro-4-oxoquinoline-3-carboxylic acid |
| SMILES | CC1CN(c2cc3c(cc2[N+](=O)[O-])c(=O)c(C(=O)O)cn3-c2ccc([N+](=O)[O-])cc2[N+](=O)[O-])CCN1C |
| InChI | InChI=1S/C22H20N6O9/c1-12-10-24(6-5-23(12)2)18-9-17-14(8-20(18)28(36)37)21(29)15(22(30)31)11-25(17)16-4-3-13(26(32)33)7-19(16)27(34)35/h3-4,7-9,11-12H,5-6,10H2,1-2H3,(H,30,31) |
| InChIKey | AYEDZJUGKUGYOD-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 195.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.44 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|