C16H22N4O5 — CID 3124720
1-(2,4-dinitrophenyl)-N,N-diethylpiperidine-3-carboxamide (PubChem CID 3124720) has the molecular formula C16H22N4O5 and a molecular weight of 350.38 g/mol. Its IUPAC name is 1-(2,4-dinitrophenyl)-N,N-diethylpiperidine-3-carboxamide.
| Compound Name | 1-(2,4-dinitrophenyl)-N,N-diethylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 3124720 |
| Molecular Formula | C16H22N4O5 |
| Molecular Weight | 350.38 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | 1-(2,4-dinitrophenyl)-N,N-diethylpiperidine-3-carboxamide |
| SMILES | CCN(CC)C(=O)C1CCCN(c2ccc([N+](=O)[O-])cc2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C16H22N4O5/c1-3-17(4-2)16(21)12-6-5-9-18(11-12)14-8-7-13(19(22)23)10-15(14)20(24)25/h7-8,10,12H,3-6,9,11H2,1-2H3 |
| InChIKey | CZFGYVSIPBBSSB-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 109.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.38 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|