C32H44N6O6S — CID 98070874
(3S)-N,N-diethyl-1-[2-[(4-morpholin-4-yl-3-piperidin-1-ylsulfonylphenyl)iminomethyl]-4-nitrophenyl]piperidine-3-carboxamide (PubChem CID 98070874) has the molecular formula C32H44N6O6S and a molecular weight of 640.81 g/mol. Its IUPAC name is (3S)-N,N-diethyl-1-[2-[(4-morpholin-4-yl-3-piperidin-1-ylsulfonylphenyl)iminomethyl]-4-nitrophenyl]piperidine-3-carboxamide.
| Compound Name | (3S)-N,N-diethyl-1-[2-[(4-morpholin-4-yl-3-piperidin-1-ylsulfonylphenyl)iminomethyl]-4-nitrophenyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 98070874 |
| Molecular Formula | C32H44N6O6S |
| Molecular Weight | 640.81 g/mol |
| Exact Mass | 640.30 |
| IUPAC Name | (3S)-N,N-diethyl-1-[2-[(4-morpholin-4-yl-3-piperidin-1-ylsulfonylphenyl)iminomethyl]-4-nitrophenyl]piperidine-3-carboxamide |
| SMILES | CCN(CC)C(=O)[C@H]1CCCN(c2ccc([N+](=O)[O-])cc2/C=N/c2ccc(N3CCOCC3)c(S(=O)(=O)N3CCCCC3)c2)C1 |
| InChI | InChI=1S/C32H44N6O6S/c1-3-34(4-2)32(39)25-9-8-14-36(24-25)29-13-11-28(38(40)41)21-26(29)23-33-27-10-12-30(35-17-19-44-20-18-35)31(22-27)45(42,43)37-15-6-5-7-16-37/h10-13,21-23,25H,3-9,14-20,24H2,1-2H3/b33-23+/t25-/m0/s1 |
| InChIKey | LPBDXPBGPARSTL-IGKMFZNPSA-N |
| XLogP | 4.44 |
| TPSA | 128.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.81 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|