C18H26N6O4 — CID 3289715
1-[2-[(carbamoylhydrazinylidene)methyl]-4-nitrophenyl]-N,N-diethylpiperidine-3-carboxamide (PubChem CID 3289715) has the molecular formula C18H26N6O4 and a molecular weight of 390.44 g/mol. Its IUPAC name is 1-[2-[(carbamoylhydrazinylidene)methyl]-4-nitrophenyl]-N,N-diethylpiperidine-3-carboxamide.
| Compound Name | 1-[2-[(carbamoylhydrazinylidene)methyl]-4-nitrophenyl]-N,N-diethylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 3289715 |
| Molecular Formula | C18H26N6O4 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.20 |
| IUPAC Name | 1-[2-[(carbamoylhydrazinylidene)methyl]-4-nitrophenyl]-N,N-diethylpiperidine-3-carboxamide |
| SMILES | CCN(CC)C(=O)C1CCCN(c2ccc([N+](=O)[O-])cc2C=NNC(N)=O)C1 |
| InChI | InChI=1S/C18H26N6O4/c1-3-22(4-2)17(25)13-6-5-9-23(12-13)16-8-7-15(24(27)28)10-14(16)11-20-21-18(19)26/h7-8,10-11,13H,3-6,9,12H2,1-2H3,(H3,19,21,26) |
| InChIKey | POTABDUQTSLAKS-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 134.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|