C16H21N5O5 — CID 168532604
ethyl 1-[2-[(carbamoylhydrazinylidene)methyl]-4-nitrophenyl]piperidine-4-carboxylate (PubChem CID 168532604) has the molecular formula C16H21N5O5 and a molecular weight of 363.37 g/mol. Its IUPAC name is ethyl 1-[2-[(carbamoylhydrazinylidene)methyl]-4-nitrophenyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[2-[(carbamoylhydrazinylidene)methyl]-4-nitrophenyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 168532604 |
| Molecular Formula | C16H21N5O5 |
| Molecular Weight | 363.37 g/mol |
| Exact Mass | 363.15 |
| IUPAC Name | ethyl 1-[2-[(carbamoylhydrazinylidene)methyl]-4-nitrophenyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(c2ccc([N+](=O)[O-])cc2C=NNC(N)=O)CC1 |
| InChI | InChI=1S/C16H21N5O5/c1-2-26-15(22)11-5-7-20(8-6-11)14-4-3-13(21(24)25)9-12(14)10-18-19-16(17)23/h3-4,9-11H,2,5-8H2,1H3,(H3,17,19,23) |
| InChIKey | GDPKBXUDCPHDBL-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 140.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.37 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|