C21H26N4O4 — CID 169385484
ethyl 1-[4-nitro-2-[(2-phenylhydrazinyl)methyl]phenyl]piperidine-4-carboxylate (PubChem CID 169385484) has the molecular formula C21H26N4O4 and a molecular weight of 398.46 g/mol. Its IUPAC name is ethyl 1-[4-nitro-2-[(2-phenylhydrazinyl)methyl]phenyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[4-nitro-2-[(2-phenylhydrazinyl)methyl]phenyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 169385484 |
| Molecular Formula | C21H26N4O4 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.20 |
| IUPAC Name | ethyl 1-[4-nitro-2-[(2-phenylhydrazinyl)methyl]phenyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(c2ccc([N+](=O)[O-])cc2CNNc2ccccc2)CC1 |
| InChI | InChI=1S/C21H26N4O4/c1-2-29-21(26)16-10-12-24(13-11-16)20-9-8-19(25(27)28)14-17(20)15-22-23-18-6-4-3-5-7-18/h3-9,14,16,22-23H,2,10-13,15H2,1H3 |
| InChIKey | PUELRBBQQVVAJH-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 96.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|