C22H27N5O6S — CID 168623746
ethyl 1-[2-[[[4-(2-ethoxy-2-oxoethyl)-1,3-thiazol-2-yl]hydrazinylidene]methyl]-4-nitrophenyl]piperidine-4-carboxylate (PubChem CID 168623746) has the molecular formula C22H27N5O6S and a molecular weight of 489.55 g/mol. Its IUPAC name is ethyl 1-[2-[[[4-(2-ethoxy-2-oxoethyl)-1,3-thiazol-2-yl]hydrazinylidene]methyl]-4-nitrophenyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[2-[[[4-(2-ethoxy-2-oxoethyl)-1,3-thiazol-2-yl]hydrazinylidene]methyl]-4-nitrophenyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 168623746 |
| Molecular Formula | C22H27N5O6S |
| Molecular Weight | 489.55 g/mol |
| Exact Mass | 489.17 |
| IUPAC Name | ethyl 1-[2-[[[4-(2-ethoxy-2-oxoethyl)-1,3-thiazol-2-yl]hydrazinylidene]methyl]-4-nitrophenyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)Cc1csc(NN=Cc2cc([N+](=O)[O-])ccc2N2CCC(C(=O)OCC)CC2)n1 |
| InChI | InChI=1S/C22H27N5O6S/c1-3-32-20(28)12-17-14-34-22(24-17)25-23-13-16-11-18(27(30)31)5-6-19(16)26-9-7-15(8-10-26)21(29)33-4-2/h5-6,11,13-15H,3-4,7-10,12H2,1-2H3,(H,24,25) |
| InChIKey | IYQMANGVWMGZRD-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 136.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.55 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|