C20H24N4O4S2 — CID 168625106
ethyl 2-[2-[2-[(2-cyclohexylsulfanyl-5-nitrophenyl)methylidene]hydrazinyl]-1,3-thiazol-4-yl]acetate (PubChem CID 168625106) has the molecular formula C20H24N4O4S2 and a molecular weight of 448.57 g/mol. Its IUPAC name is ethyl 2-[2-[2-[(2-cyclohexylsulfanyl-5-nitrophenyl)methylidene]hydrazinyl]-1,3-thiazol-4-yl]acetate.
| Compound Name | ethyl 2-[2-[2-[(2-cyclohexylsulfanyl-5-nitrophenyl)methylidene]hydrazinyl]-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 168625106 |
| Molecular Formula | C20H24N4O4S2 |
| Molecular Weight | 448.57 g/mol |
| Exact Mass | 448.12 |
| IUPAC Name | ethyl 2-[2-[2-[(2-cyclohexylsulfanyl-5-nitrophenyl)methylidene]hydrazinyl]-1,3-thiazol-4-yl]acetate |
| SMILES | CCOC(=O)Cc1csc(NN=Cc2cc([N+](=O)[O-])ccc2SC2CCCCC2)n1 |
| InChI | InChI=1S/C20H24N4O4S2/c1-2-28-19(25)11-15-13-29-20(22-15)23-21-12-14-10-16(24(26)27)8-9-18(14)30-17-6-4-3-5-7-17/h8-10,12-13,17H,2-7,11H2,1H3,(H,22,23) |
| InChIKey | DWNOMAWSENRRQA-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 106.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.57 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|